C45H62O10 — CID 160834120
(5-hydroxy-2,3-dihydro-1H-inden-2-yl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate;6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl 2,2-dimethylbutanoate (PubChem CID 160834120) has the molecular formula C45H62O10 and a molecular weight of 762.98 g/mol. Its IUPAC name is (5-hydroxy-2,3-dihydro-1H-inden-2-yl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate;6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl 2,2-dimethylbutanoate.
| Compound Name | (5-hydroxy-2,3-dihydro-1H-inden-2-yl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate;6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160834120 |
| Molecular Formula | C45H62O10 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.43 |
| IUPAC Name | (5-hydroxy-2,3-dihydro-1H-inden-2-yl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate;6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C(=O)OC1C3O2.CCC(C)(C)C(=O)OC1CCCCc2ccccc21.CCC(C)(C)C(=O)OC1Cc2ccc(O)cc2C1 |
| InChI | InChI=1S/C17H24O2.C15H20O3.C13H18O5/c1-4-17(2,3)16(18)19-15-12-8-6-10-13-9-5-7-11-14(13)15;1-4-15(2,3)14(17)18-13-8-10-5-6-12(16)7-11(10)9-13;1-4-13(2,3)12(15)18-9-7-5-6-8(16-7)10(9)17-11(6)14/h5,7,9,11,15H,4,6,8,10,12H2,1-3H3;5-7,13,16H,4,8-9H2,1-3H3;6-10H,4-5H2,1-3H3 |
| InChIKey | SHEMYDCLFFJWJJ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|