C39H65N5O11 — CID 160834706
2-ethyl-6-methyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)heptanoic acid;2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid;prop-2-enoic acid (PubChem CID 160834706) has the molecular formula C39H65N5O11 and a molecular weight of 779.97 g/mol. Its IUPAC name is 2-ethyl-6-methyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)heptanoic acid;2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid;prop-2-enoic acid.
| Compound Name | 2-ethyl-6-methyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)heptanoic acid;2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 160834706 |
| Molecular Formula | C39H65N5O11 |
| Molecular Weight | 779.97 g/mol |
| Exact Mass | 779.47 |
| IUPAC Name | 2-ethyl-6-methyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)heptanoic acid;2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)NC(CC(CC(CC)C(=O)O)N1CCCC1=O)C(=O)NC(C)C.C=CC(=O)O.CCC(CC(CC(C)C(=O)NC(C)C)N1CCCC1=O)C(=O)O |
| InChI | InChI=1S/C19H31N3O5.C17H30N2O4.C3H4O2/c1-5-13(19(26)27)10-14(22-9-7-8-17(22)24)11-15(21-16(23)6-2)18(25)20-12(3)4;1-5-13(17(22)23)10-14(19-8-6-7-15(19)20)9-12(4)16(21)18-11(2)3;1-2-3(4)5/h6,12-15H,2,5,7-11H2,1,3-4H3,(H,20,25)(H,21,23)(H,26,27);11-14H,5-10H2,1-4H3,(H,18,21)(H,22,23);2H,1H2,(H,4,5) |
| InChIKey | SHGLAUUIUZEYRF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 239.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|