C19H31N3O5 — CID 58731090
2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid (PubChem CID 58731090) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid.
| Compound Name | 2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid |
|---|---|
| PubChem CID | 58731090 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-ethyl-7-oxo-4-(2-oxopyrrolidin-1-yl)-7-(propan-2-ylamino)-6-(prop-2-enoylamino)heptanoic acid |
| SMILES | C=CC(=O)NC(CC(CC(CC)C(=O)O)N1CCCC1=O)C(=O)NC(C)C |
| InChI | InChI=1S/C19H31N3O5/c1-5-13(19(26)27)10-14(22-9-7-8-17(22)24)11-15(21-16(23)6-2)18(25)20-12(3)4/h6,12-15H,2,5,7-11H2,1,3-4H3,(H,20,25)(H,21,23)(H,26,27) |
| InChIKey | WJPKGHBDRQOLTP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|