C18H26N2O5 — CID 57241054
6-[[2-cyclohexyl-2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid (PubChem CID 57241054) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-[[2-cyclohexyl-2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-cyclohexyl-2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 57241054 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 6-[[2-cyclohexyl-2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(C1CCCCC1)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H26N2O5/c21-14-10-11-15(22)20(14)17(13-7-3-1-4-8-13)18(25)19-12-6-2-5-9-16(23)24/h10-11,13,17H,1-9,12H2,(H,19,25)(H,23,24) |
| InChIKey | FKXOARJMAQGLBA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|