C18H26N2O6 — CID 130404199
carboxy 6-amino-6-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate (PubChem CID 130404199) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is carboxy 6-amino-6-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate.
| Compound Name | carboxy 6-amino-6-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate |
|---|---|
| PubChem CID | 130404199 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | carboxy 6-amino-6-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate |
| SMILES | NC(CCCCC(=O)OC(=O)O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C18H26N2O6/c19-14(3-1-2-4-17(23)26-18(24)25)13-7-5-12(6-8-13)11-20-15(21)9-10-16(20)22/h9-10,12-14H,1-8,11,19H2,(H,24,25) |
| InChIKey | UQYPQYXQTHBNSJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|