C18H26N2O6 — CID 68764613
2-(4-aminobutyl)-2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanedioic acid (PubChem CID 68764613) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-(4-aminobutyl)-2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanedioic acid.
| Compound Name | 2-(4-aminobutyl)-2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanedioic acid |
|---|---|
| PubChem CID | 68764613 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-(4-aminobutyl)-2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanedioic acid |
| SMILES | NCCCCC(C(=O)O)(C(=O)O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C18H26N2O6/c19-10-2-1-9-18(16(23)24,17(25)26)13-5-3-12(4-6-13)11-20-14(21)7-8-15(20)22/h7-8,12-13H,1-6,9-11,19H2,(H,23,24)(H,25,26) |
| InChIKey | UKCHVKQGQRXLKX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|