C20H28N2O5 — CID 68742266
4-[[[1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 68742266) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-[[[1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 68742266 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[[[1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNC(=O)C2(CN3C(=O)C=CC3=O)CCCCC2)CC1 |
| InChI | InChI=1S/C20H28N2O5/c23-16-8-9-17(24)22(16)13-20(10-2-1-3-11-20)19(27)21-12-14-4-6-15(7-5-14)18(25)26/h8-9,14-15H,1-7,10-13H2,(H,21,27)(H,25,26) |
| InChIKey | IWTDIWXGZIZJHI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|