C18H26N2O5 — CID 137425627
6-aminohexanoyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 137425627) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-aminohexanoyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | 6-aminohexanoyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 137425627 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 6-aminohexanoyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | NCCCCCC(=O)OC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C18H26N2O5/c19-11-3-1-2-4-17(23)25-18(24)14-7-5-13(6-8-14)12-20-15(21)9-10-16(20)22/h9-10,13-14H,1-8,11-12,19H2 |
| InChIKey | VBJFRKWWTQKSFX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|