C22H27N3O7 — CID 58592351
(2,5-dioxopyrrol-1-yl) 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate (PubChem CID 58592351) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 58592351 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H27N3O7/c26-17-9-10-18(27)24(17)14-15-5-7-16(8-6-15)22(31)23-13-3-1-2-4-21(30)32-25-19(28)11-12-20(25)29/h9-12,15-16H,1-8,13-14H2,(H,23,31) |
| InChIKey | IZBUYTLUBJKWSV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|