C18H28N2O6 — CID 87288686
carboxy 6-aminohexanoate;1-(cyclohexylmethyl)pyrrole-2,5-dione (PubChem CID 87288686) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is carboxy 6-aminohexanoate;1-(cyclohexylmethyl)pyrrole-2,5-dione.
| Compound Name | carboxy 6-aminohexanoate;1-(cyclohexylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87288686 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | carboxy 6-aminohexanoate;1-(cyclohexylmethyl)pyrrole-2,5-dione |
| SMILES | NCCCCCC(=O)OC(=O)O.O=C1C=CC(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C11H15NO2.C7H13NO4/c13-10-6-7-11(14)12(10)8-9-4-2-1-3-5-9;8-5-3-1-2-4-6(9)12-7(10)11/h6-7,9H,1-5,8H2;1-5,8H2,(H,10,11) |
| InChIKey | DNSPUUNWJGBVPH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|