C26H39N3O8 — CID 87167982
carboxy 6-aminodecanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 87167982) has the molecular formula C26H39N3O8 and a molecular weight of 521.61 g/mol. Its IUPAC name is carboxy 6-aminodecanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | carboxy 6-aminodecanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87167982 |
| Molecular Formula | C26H39N3O8 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | carboxy 6-aminodecanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | CCCCC(N)CCCCC(=O)OC(=O)O.O=C1C=CC(=O)N1CC1CCC(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C15H18N2O4.C11H21NO4/c18-12-5-6-13(19)16(12)9-10-1-3-11(4-2-10)17-14(20)7-8-15(17)21;1-2-3-6-9(12)7-4-5-8-10(13)16-11(14)15/h5-6,10-11H,1-4,7-9H2;9H,2-8,12H2,1H3,(H,14,15) |
| InChIKey | QUPFZPDAQVCCDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|