C22H29N3O8 — CID 22146486
carboxy 6-amino-2-[1-(2,5-dioxopyrrolidin-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate (PubChem CID 22146486) has the molecular formula C22H29N3O8 and a molecular weight of 463.49 g/mol. Its IUPAC name is carboxy 6-amino-2-[1-(2,5-dioxopyrrolidin-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate.
| Compound Name | carboxy 6-amino-2-[1-(2,5-dioxopyrrolidin-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate |
|---|---|
| PubChem CID | 22146486 |
| Molecular Formula | C22H29N3O8 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | carboxy 6-amino-2-[1-(2,5-dioxopyrrolidin-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]hexanoate |
| SMILES | NCCCCC(C(=O)OC(=O)O)C1(N2C(=O)CCC2=O)CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C22H29N3O8/c23-12-2-1-3-15(20(30)33-21(31)32)22(25-18(28)6-7-19(25)29)10-8-14(9-11-22)13-24-16(26)4-5-17(24)27/h4-5,14-15H,1-3,6-13,23H2,(H,31,32) |
| InChIKey | CYSKOFBQDUKQJZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|