C23H32N2O8 — CID 143845139
[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate;methane (PubChem CID 143845139) has the molecular formula C23H32N2O8 and a molecular weight of 464.52 g/mol. Its IUPAC name is [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate;methane.
| Compound Name | [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate;methane |
|---|---|
| PubChem CID | 143845139 |
| Molecular Formula | C23H32N2O8 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate;methane |
| SMILES | C.O=C(CCCCCOC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H28N2O8.CH4/c25-17-9-10-18(26)23(17)14-15-5-7-16(8-6-15)22(30)31-13-3-1-2-4-21(29)32-24-19(27)11-12-20(24)28;/h9-10,15-16H,1-8,11-14H2;1H4 |
| InChIKey | LHRSKEINDAQBCI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|