C22H30N2O8 — CID 123753393
[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl] 4-[(2,5-dihydroxypyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 123753393) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is [6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl] 4-[(2,5-dihydroxypyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | [6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl] 4-[(2,5-dihydroxypyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123753393 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl] 4-[(2,5-dihydroxypyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(CCCCCOC(=O)C1CCC(Cn2c(O)ccc2O)CC1)On1c(O)ccc1O |
| InChI | InChI=1S/C22H30N2O8/c25-17-9-10-18(26)23(17)14-15-5-7-16(8-6-15)22(30)31-13-3-1-2-4-21(29)32-24-19(27)11-12-20(24)28/h9-12,15-16,25-28H,1-8,13-14H2 |
| InChIKey | GTAJABHPMQGWKL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|