C25H41N3O7 — CID 164924628
(4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6-methyl-5-oxoheptanoic acid;ethane (PubChem CID 164924628) has the molecular formula C25H41N3O7 and a molecular weight of 495.62 g/mol. Its IUPAC name is (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6-methyl-5-oxoheptanoic acid;ethane.
| Compound Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6-methyl-5-oxoheptanoic acid;ethane |
|---|---|
| PubChem CID | 164924628 |
| Molecular Formula | C25H41N3O7 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6-methyl-5-oxoheptanoic acid;ethane |
| SMILES | CC.CC(C)C(=O)[C@H](CCC(=O)O)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C23H35N3O7.C2H6/c1-14(2)21(23(33)24-16(9-12-20(30)31)22(32)15(3)4)25-17(27)8-6-5-7-13-26-18(28)10-11-19(26)29;1-2/h10-11,14-16,21H,5-9,12-13H2,1-4H3,(H,24,33)(H,25,27)(H,30,31);1-2H3/t16-,21?;/m0./s1 |
| InChIKey | KBGMDPRGMCCQNO-OOJQBDKLSA-N |
| XLogP | 2.21 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|