C15H20N2O6 — CID 147015527
(2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2,6-dimethyl-4-oxoheptanoic acid (PubChem CID 147015527) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2,6-dimethyl-4-oxoheptanoic acid.
| Compound Name | (2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2,6-dimethyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 147015527 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2R,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-2,6-dimethyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c1-8(2)14(10(18)6-9(3)15(22)23)16-11(19)7-17-12(20)4-5-13(17)21/h4-5,8-9,14H,6-7H2,1-3H3,(H,16,19)(H,22,23)/t9-,14+/m1/s1 |
| InChIKey | AURQANSDADCULO-OTYXRUKQSA-N |
| XLogP | -0.27 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|