C21H32N2O7 — CID 159699425
5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid;methane (PubChem CID 159699425) has the molecular formula C21H32N2O7 and a molecular weight of 424.49 g/mol. Its IUPAC name is 5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid;methane.
| Compound Name | 5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid;methane |
|---|---|
| PubChem CID | 159699425 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid;methane |
| SMILES | C.CC(CC(=O)C(C)NC(=O)CCCCC(=O)CCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C20H28N2O7.CH4/c1-13(20(28)29)12-16(24)14(2)21-17(25)8-4-3-6-15(23)7-5-11-22-18(26)9-10-19(22)27;/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,21,25)(H,28,29);1H4 |
| InChIKey | MXKWYTBRZZPFQL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|