C24H37N3O7 — CID 142572245
(4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxoheptanoic acid (PubChem CID 142572245) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxoheptanoic acid.
| Compound Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 142572245 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxoheptanoic acid |
| SMILES | CC(C)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCC(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H37N3O7/c1-15(2)21(23(34)25-16(10-13-20(31)32)22(33)24(3,4)5)26-17(28)9-7-6-8-14-27-18(29)11-12-19(27)30/h11-12,15-16,21H,6-10,13-14H2,1-5H3,(H,25,34)(H,26,28)(H,31,32)/t16-,21?/m0/s1 |
| InChIKey | WWWWUQBXJUNKKW-BJQOMGFOSA-N |
| XLogP | 1.58 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|