C22H33N3O7S — CID 139417334
(4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-6-sulfanylheptanoic acid (PubChem CID 139417334) has the molecular formula C22H33N3O7S and a molecular weight of 483.59 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-6-sulfanylheptanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-6-sulfanylheptanoic acid |
|---|---|
| PubChem CID | 139417334 |
| Molecular Formula | C22H33N3O7S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-6-sulfanylheptanoic acid |
| SMILES | CC(S)C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C22H33N3O7S/c1-13(2)20(22(32)23-15(8-11-19(29)30)21(31)14(3)33)24-16(26)7-5-4-6-12-25-17(27)9-10-18(25)28/h9-10,13-15,20,33H,4-8,11-12H2,1-3H3,(H,23,32)(H,24,26)(H,29,30)/t14?,15-,20-/m0/s1 |
| InChIKey | SQZKTNFWYVWYBN-NEYBVYDXSA-N |
| XLogP | 0.85 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|