C17H26Cl2N4O — CID 160837655
1-[(2R)-2-isocyanopyrrolidin-1-yl]-2-[3-(N-methylanilino)propylamino]ethanone;dihydrochloride (PubChem CID 160837655) has the molecular formula C17H26Cl2N4O and a molecular weight of 373.33 g/mol. Its IUPAC name is 1-[(2R)-2-isocyanopyrrolidin-1-yl]-2-[3-(N-methylanilino)propylamino]ethanone;dihydrochloride.
| Compound Name | 1-[(2R)-2-isocyanopyrrolidin-1-yl]-2-[3-(N-methylanilino)propylamino]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 160837655 |
| Molecular Formula | C17H26Cl2N4O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[(2R)-2-isocyanopyrrolidin-1-yl]-2-[3-(N-methylanilino)propylamino]ethanone;dihydrochloride |
| SMILES | Cl.Cl.[C-]#[N+][C@@H]1CCCN1C(=O)CNCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O.2ClH/c1-18-16-10-6-13-21(16)17(22)14-19-11-7-12-20(2)15-8-4-3-5-9-15;;/h3-5,8-9,16,19H,6-7,10-14H2,2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | BQCAOXJMZPAEPM-SQKCAUCHSA-N |
| XLogP | 2.81 |
| TPSA | 39.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|