C25H30ClF6NO — CID 160842842
2-[chloro(difluoro)methoxy]-1,3,5-trifluorobenzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentylpyridine (PubChem CID 160842842) has the molecular formula C25H30ClF6NO and a molecular weight of 509.96 g/mol. Its IUPAC name is 2-[chloro(difluoro)methoxy]-1,3,5-trifluorobenzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentylpyridine.
| Compound Name | 2-[chloro(difluoro)methoxy]-1,3,5-trifluorobenzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentylpyridine |
|---|---|
| PubChem CID | 160842842 |
| Molecular Formula | C25H30ClF6NO |
| Molecular Weight | 509.96 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-[chloro(difluoro)methoxy]-1,3,5-trifluorobenzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentylpyridine |
| SMILES | CCCCCc1ccc(C2CCC(CCF)CC2)nc1.Fc1cc(F)c(OC(F)(F)Cl)c(F)c1 |
| InChI | InChI=1S/C18H28FN.C7H2ClF5O/c1-2-3-4-5-16-8-11-18(20-14-16)17-9-6-15(7-10-17)12-13-19;8-7(12,13)14-6-4(10)1-3(9)2-5(6)11/h8,11,14-15,17H,2-7,9-10,12-13H2,1H3;1-2H |
| InChIKey | SIGHUIXGJCSKIC-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.96 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|