C32H35ClF6O — CID 158917041
2-[chloro(difluoro)methoxy]-1,3-difluoro-5-(4-fluorophenyl)benzene;1-[4-(2-fluoroethyl)cyclohexyl]-4-pentylbenzene (PubChem CID 158917041) has the molecular formula C32H35ClF6O and a molecular weight of 585.07 g/mol. Its IUPAC name is 2-[chloro(difluoro)methoxy]-1,3-difluoro-5-(4-fluorophenyl)benzene;1-[4-(2-fluoroethyl)cyclohexyl]-4-pentylbenzene.
| Compound Name | 2-[chloro(difluoro)methoxy]-1,3-difluoro-5-(4-fluorophenyl)benzene;1-[4-(2-fluoroethyl)cyclohexyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 158917041 |
| Molecular Formula | C32H35ClF6O |
| Molecular Weight | 585.07 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 2-[chloro(difluoro)methoxy]-1,3-difluoro-5-(4-fluorophenyl)benzene;1-[4-(2-fluoroethyl)cyclohexyl]-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C2CCC(CCF)CC2)cc1.Fc1ccc(-c2cc(F)c(OC(F)(F)Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C19H29F.C13H6ClF5O/c1-2-3-4-5-16-6-10-18(11-7-16)19-12-8-17(9-13-19)14-15-20;14-13(18,19)20-12-10(16)5-8(6-11(12)17)7-1-3-9(15)4-2-7/h6-7,10-11,17,19H,2-5,8-9,12-15H2,1H3;1-6H |
| InChIKey | JHIWISILTWQTFH-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.07 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|