C40H70O2 — CID 160846941
9-[[(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-(2-methylpropyl)nonan-2-one (PubChem CID 160846941) has the molecular formula C40H70O2 and a molecular weight of 583.00 g/mol. Its IUPAC name is 9-[[(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-(2-methylpropyl)nonan-2-one.
| Compound Name | 9-[[(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-(2-methylpropyl)nonan-2-one |
|---|---|
| PubChem CID | 160846941 |
| Molecular Formula | C40H70O2 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.54 |
| IUPAC Name | 9-[[(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3-(2-methylpropyl)nonan-2-one |
| SMILES | CC(=O)C(CCCCCCO[C@H]1CC[C@@]2(C)C(=CC[C@H]3C4CCC(C(C)CCCC(C)C)[C@@]4(C)CCC32)C1)CC(C)C |
| InChI | InChI=1S/C40H70O2/c1-28(2)14-13-15-30(5)36-19-20-37-35-18-17-33-27-34(21-23-39(33,7)38(35)22-24-40(36,37)8)42-25-12-10-9-11-16-32(31(6)41)26-29(3)4/h17,28-30,32,34-38H,9-16,18-27H2,1-8H3/t30?,32?,34-,35-,36?,37?,38?,39-,40+/m0/s1 |
| InChIKey | SITKUJWFYUFSGQ-LEIJMIQFSA-N |
| XLogP | 11.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|