C28H32N2O3S — CID 160847455
(5S)-3-(pyrrolidin-1-ylmethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one;sulfane (PubChem CID 160847455) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is (5S)-3-(pyrrolidin-1-ylmethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one;sulfane.
| Compound Name | (5S)-3-(pyrrolidin-1-ylmethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one;sulfane |
|---|---|
| PubChem CID | 160847455 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (5S)-3-(pyrrolidin-1-ylmethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one;sulfane |
| SMILES | O=C1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1CN1CCCC1.S |
| InChI | InChI=1S/C28H30N2O3.H2S/c31-27-30(22-29-18-10-11-19-29)20-26(33-27)21-32-28(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25;/h1-9,12-17,26H,10-11,18-22H2;1H2/t26-;/m0./s1 |
| InChIKey | SIVCWFRGHZGYFO-SNYZSRNZSA-N |
| XLogP | 4.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|