C10H14N3Na3O11 — CID 160853423
trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;nitrate (PubChem CID 160853423) has the molecular formula C10H14N3Na3O11 and a molecular weight of 421.20 g/mol. Its IUPAC name is trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;nitrate.
| Compound Name | trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;nitrate |
|---|---|
| PubChem CID | 160853423 |
| Molecular Formula | C10H14N3Na3O11 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;nitrate |
| SMILES | O=C([O-])CN(CCN(CC(=O)O)CC(=O)O)CC(=O)[O-].O=[N+]([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.NO3.3Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;2-1(3)4;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;/q;-1;3*+1/p-2 |
| InChIKey | SJODAVPNMYBVHX-UHFFFAOYSA-L |
| XLogP | -13.97 |
| TPSA | 227.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | -13.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|