C36H30BBrF6N4O4 — CID 160853616
3-bromoimidazo[1,2-a]pyridine;4-imidazo[1,2-a]pyridin-3-yl-2-(trifluoromethyl)benzaldehyde;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzaldehyde (PubChem CID 160853616) has the molecular formula C36H30BBrF6N4O4 and a molecular weight of 787.36 g/mol. Its IUPAC name is 3-bromoimidazo[1,2-a]pyridine;4-imidazo[1,2-a]pyridin-3-yl-2-(trifluoromethyl)benzaldehyde;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-bromoimidazo[1,2-a]pyridine;4-imidazo[1,2-a]pyridin-3-yl-2-(trifluoromethyl)benzaldehyde;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 160853616 |
| Molecular Formula | C36H30BBrF6N4O4 |
| Molecular Weight | 787.36 g/mol |
| Exact Mass | 786.14 |
| IUPAC Name | 3-bromoimidazo[1,2-a]pyridine;4-imidazo[1,2-a]pyridin-3-yl-2-(trifluoromethyl)benzaldehyde;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzaldehyde |
| SMILES | Brc1cnc2ccccn12.CC1(C)OB(c2ccc(C=O)c(C(F)(F)F)c2)OC1(C)C.O=Cc1ccc(-c2cnc3ccccn23)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9F3N2O.C14H16BF3O3.C7H5BrN2/c16-15(17,18)12-7-10(4-5-11(12)9-21)13-8-19-14-3-1-2-6-20(13)14;1-12(2)13(3,4)21-15(20-12)10-6-5-9(8-19)11(7-10)14(16,17)18;8-6-5-9-7-3-1-2-4-10(6)7/h1-9H;5-8H,1-4H3;1-5H |
| InChIKey | SJOVEKWAUPKHED-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.36 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|