C26H31NO3Si — CID 160854922
(2R)-2-[methyl(silyloxy)amino]-3-phenyl-2-(4-phenylphenyl)heptanoic acid (PubChem CID 160854922) has the molecular formula C26H31NO3Si and a molecular weight of 433.62 g/mol. Its IUPAC name is (2R)-2-[methyl(silyloxy)amino]-3-phenyl-2-(4-phenylphenyl)heptanoic acid.
| Compound Name | (2R)-2-[methyl(silyloxy)amino]-3-phenyl-2-(4-phenylphenyl)heptanoic acid |
|---|---|
| PubChem CID | 160854922 |
| Molecular Formula | C26H31NO3Si |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (2R)-2-[methyl(silyloxy)amino]-3-phenyl-2-(4-phenylphenyl)heptanoic acid |
| SMILES | CCCCC(c1ccccc1)[C@](C(=O)O)(c1ccc(-c2ccccc2)cc1)N(C)O[SiH3] |
| InChI | InChI=1S/C26H31NO3Si/c1-3-4-15-24(22-13-9-6-10-14-22)26(25(28)29,27(2)30-31)23-18-16-21(17-19-23)20-11-7-5-8-12-20/h5-14,16-19,24H,3-4,15H2,1-2,31H3,(H,28,29)/t24?,26-/m0/s1 |
| InChIKey | SJSVSSXOQKRMHM-JKGBFCRXSA-N |
| XLogP | 4.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|