C17H19F4NO3 — CID 160858869
tert-butyl (2S)-2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]acetyl]azetidine-1-carboxylate (PubChem CID 160858869) has the molecular formula C17H19F4NO3 and a molecular weight of 361.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]acetyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]acetyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 160858869 |
| Molecular Formula | C17H19F4NO3 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl (2S)-2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]acetyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F4NO3/c1-16(2,3)25-15(24)22-7-6-13(22)14(23)9-10-4-5-12(18)11(8-10)17(19,20)21/h4-5,8,13H,6-7,9H2,1-3H3/t13-/m0/s1 |
| InChIKey | SKFKFYMBABNKFQ-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |