C18H28N4O — CID 160865702
3-cyclohexyl-3-oxopropanenitrile;5-cyclohexyl-1H-pyrazol-3-amine (PubChem CID 160865702) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-cyclohexyl-3-oxopropanenitrile;5-cyclohexyl-1H-pyrazol-3-amine.
| Compound Name | 3-cyclohexyl-3-oxopropanenitrile;5-cyclohexyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 160865702 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 3-cyclohexyl-3-oxopropanenitrile;5-cyclohexyl-1H-pyrazol-3-amine |
| SMILES | N#CCC(=O)C1CCCCC1.Nc1cc(C2CCCCC2)[nH]n1 |
| InChI | InChI=1S/C9H15N3.C9H13NO/c10-9-6-8(11-12-9)7-4-2-1-3-5-7;10-7-6-9(11)8-4-2-1-3-5-8/h6-7H,1-5H2,(H3,10,11,12);8H,1-6H2 |
| InChIKey | SLBZJVYCWJDPKE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |