C19H22ClN5O2S — CID 160866806
1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanone;4-(triazol-1-yl)phenol (PubChem CID 160866806) has the molecular formula C19H22ClN5O2S and a molecular weight of 419.94 g/mol. Its IUPAC name is 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanone;4-(triazol-1-yl)phenol.
| Compound Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanone;4-(triazol-1-yl)phenol |
|---|---|
| PubChem CID | 160866806 |
| Molecular Formula | C19H22ClN5O2S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanone;4-(triazol-1-yl)phenol |
| SMILES | CC(=O)N1CCC(c2nc(CCl)cs2)CC1.Oc1ccc(-n2ccnn2)cc1 |
| InChI | InChI=1S/C11H15ClN2OS.C8H7N3O/c1-8(15)14-4-2-9(3-5-14)11-13-10(6-12)7-16-11;12-8-3-1-7(2-4-8)11-6-5-9-10-11/h7,9H,2-6H2,1H3;1-6,12H |
| InChIKey | SLFLXMBAHMUYJE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|