C19H20N6O4S — CID 25025307
methyl 2-oxo-2-[4-[4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]acetate (PubChem CID 25025307) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is methyl 2-oxo-2-[4-[4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-oxo-2-[4-[4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 25025307 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | methyl 2-oxo-2-[4-[4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]acetate |
| SMILES | COC(=O)C(=O)N1CCC(c2nc(COc3ccc(-n4cnnn4)cc3)cs2)CC1 |
| InChI | InChI=1S/C19H20N6O4S/c1-28-19(27)18(26)24-8-6-13(7-9-24)17-21-14(11-30-17)10-29-16-4-2-15(3-5-16)25-12-20-22-23-25/h2-5,11-13H,6-10H2,1H3 |
| InChIKey | YUPJEIAGIRNZKE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 112.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|