C24H30N8O4S2 — CID 51347382
ethanesulfonic acid;2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole (PubChem CID 51347382) has the molecular formula C24H30N8O4S2 and a molecular weight of 558.69 g/mol. Its IUPAC name is ethanesulfonic acid;2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole.
| Compound Name | ethanesulfonic acid;2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 51347382 |
| Molecular Formula | C24H30N8O4S2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | ethanesulfonic acid;2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
| SMILES | CCS(=O)(=O)O.CCc1cnc(N2CCC(c3nc(COc4ccc(-n5cnnn5)cc4)cs3)CC2)nc1 |
| InChI | InChI=1S/C22H24N8OS.C2H6O3S/c1-2-16-11-23-22(24-12-16)29-9-7-17(8-10-29)21-26-18(14-32-21)13-31-20-5-3-19(4-6-20)30-15-25-27-28-30;1-2-6(3,4)5/h3-6,11-12,14-15,17H,2,7-10,13H2,1H3;2H2,1H3,(H,3,4,5) |
| InChIKey | DXTWCUCNBRWLPN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|