C25H30N8OS — CID 25025906
2-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole (PubChem CID 25025906) has the molecular formula C25H30N8OS and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole.
| Compound Name | 2-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 25025906 |
| Molecular Formula | C25H30N8OS |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
| SMILES | CCCCCc1cnc(N2CCC(c3nc(COc4ccc(-n5cnnn5)cc4)cs3)CC2)nc1 |
| InChI | InChI=1S/C25H30N8OS/c1-2-3-4-5-19-14-26-25(27-15-19)32-12-10-20(11-13-32)24-29-21(17-35-24)16-34-23-8-6-22(7-9-23)33-18-28-30-31-33/h6-9,14-15,17-18,20H,2-5,10-13,16H2,1H3 |
| InChIKey | KHXJKXCLNFQJFK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|