C19H23N5O4S — CID 143718410
methyl 2-[4-[4-[[4-(hydrazinylmethylideneamino)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoacetate (PubChem CID 143718410) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 2-[4-[4-[[4-(hydrazinylmethylideneamino)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[4-[4-[[4-(hydrazinylmethylideneamino)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 143718410 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | methyl 2-[4-[4-[[4-(hydrazinylmethylideneamino)phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N1CCC(c2nc(COc3ccc(/N=C/NN)cc3)cs2)CC1 |
| InChI | InChI=1S/C19H23N5O4S/c1-27-19(26)18(25)24-8-6-13(7-9-24)17-23-15(11-29-17)10-28-16-4-2-14(3-5-16)21-12-22-20/h2-5,11-13H,6-10,20H2,1H3,(H,21,22) |
| InChIKey | OWICNWSLJCZIQH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|