C21H26N6O4S — CID 143718396
ethyl 3-[4-[4-[[4-[(aminodiazenyl)methylideneamino]phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-oxopropanoate (PubChem CID 143718396) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is ethyl 3-[4-[4-[[4-[(aminodiazenyl)methylideneamino]phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[4-[[4-[(aminodiazenyl)methylideneamino]phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 143718396 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl 3-[4-[4-[[4-[(aminodiazenyl)methylideneamino]phenoxy]methyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCC(c2nc(COc3ccc(/N=C/N=N/N)cc3)cs2)CC1 |
| InChI | InChI=1S/C21H26N6O4S/c1-2-30-20(29)11-19(28)27-9-7-15(8-10-27)21-25-17(13-32-21)12-31-18-5-3-16(4-6-18)23-14-24-26-22/h3-6,13-15H,2,7-12H2,1H3,(H2,22,23,24) |
| InChIKey | VERDFMKXQIBMNQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|