About ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate
ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 166408511) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 166408511 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | C=CC(=O)N1CCC(c2nc(CC(=O)OCC)cs2)CC1 |
| InChI | InChI=1S/C15H20N2O3S/c1-3-13(18)17-7-5-11(6-8-17)15-16-12(10-21-15)9-14(19)20-4-2/h3,10-11H,1,4-9H2,2H3 |
| InChIKey | XDAUEDSILJZMLR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate (CID 166408511) is ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate is C=CC(=O)N1CCC(c2nc(CC(=O)OCC)cs2)CC1.
What is the InChIKey of ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate?
The InChIKey is XDAUEDSILJZMLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-3-13(18)17-7-5-11(6-8-17)15-16-12(10-21-15)9-14(19)20-4-2/h3,10-11H,1,4-9H2,2H3.
What are the key properties of ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate has a molecular weight of 308.40 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(1-prop-2-enoylpiperidin-4-yl)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 166408511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).