C23H17ClF2O3 — CID 160866934
ethyl 4-chloro-3-[4-[2-(2,6-difluorophenyl)-2-oxoethyl]phenyl]benzoate (PubChem CID 160866934) has the molecular formula C23H17ClF2O3 and a molecular weight of 414.84 g/mol. Its IUPAC name is ethyl 4-chloro-3-[4-[2-(2,6-difluorophenyl)-2-oxoethyl]phenyl]benzoate.
| Compound Name | ethyl 4-chloro-3-[4-[2-(2,6-difluorophenyl)-2-oxoethyl]phenyl]benzoate |
|---|---|
| PubChem CID | 160866934 |
| Molecular Formula | C23H17ClF2O3 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | ethyl 4-chloro-3-[4-[2-(2,6-difluorophenyl)-2-oxoethyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cl)c(-c2ccc(CC(=O)c3c(F)cccc3F)cc2)c1 |
| InChI | InChI=1S/C23H17ClF2O3/c1-2-29-23(28)16-10-11-18(24)17(13-16)15-8-6-14(7-9-15)12-21(27)22-19(25)4-3-5-20(22)26/h3-11,13H,2,12H2,1H3 |
| InChIKey | GJOZDNDCSISCEC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |