C20H14ClF2N3O3 — CID 11625878
ethyl 4-chloro-3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate (PubChem CID 11625878) has the molecular formula C20H14ClF2N3O3 and a molecular weight of 417.80 g/mol. Its IUPAC name is ethyl 4-chloro-3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate.
| Compound Name | ethyl 4-chloro-3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 11625878 |
| Molecular Formula | C20H14ClF2N3O3 |
| Molecular Weight | 417.80 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | ethyl 4-chloro-3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cl)c(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c1 |
| InChI | InChI=1S/C20H14ClF2N3O3/c1-2-29-20(28)11-6-7-13(21)12(8-11)16-9-25-17(10-24-16)26-19(27)18-14(22)4-3-5-15(18)23/h3-10H,2H2,1H3,(H,25,26,27) |
| InChIKey | BOBCRRHYNXVUTD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |