C20H18FN7O — CID 70320043
2-fluoro-N-[5-[5-(N-hydrazinylidenecarbamimidoyl)-2-methylphenyl]pyrazin-2-yl]-6-methylbenzamide (PubChem CID 70320043) has the molecular formula C20H18FN7O and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-fluoro-N-[5-[5-(N-hydrazinylidenecarbamimidoyl)-2-methylphenyl]pyrazin-2-yl]-6-methylbenzamide.
| Compound Name | 2-fluoro-N-[5-[5-(N-hydrazinylidenecarbamimidoyl)-2-methylphenyl]pyrazin-2-yl]-6-methylbenzamide |
|---|---|
| PubChem CID | 70320043 |
| Molecular Formula | C20H18FN7O |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-fluoro-N-[5-[5-(N-hydrazinylidenecarbamimidoyl)-2-methylphenyl]pyrazin-2-yl]-6-methylbenzamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc(C)c(-c2cnc(NC(=O)c3c(C)cccc3F)cn2)c1 |
| InChI | InChI=1S/C20H18FN7O/c1-11-6-7-13(19(22)27-28-23)8-14(11)16-9-25-17(10-24-16)26-20(29)18-12(2)4-3-5-15(18)21/h3-10H,1-2H3,(H3,22,23,27)(H,25,26,29) |
| InChIKey | LUHDYTGSGMAUPX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|