C19H14FN5O — CID 70320228
N-[5-(5-cyano-2-methylphenyl)pyrazin-2-yl]-3-fluoro-5-methylpyridine-4-carboxamide (PubChem CID 70320228) has the molecular formula C19H14FN5O and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[5-(5-cyano-2-methylphenyl)pyrazin-2-yl]-3-fluoro-5-methylpyridine-4-carboxamide.
| Compound Name | N-[5-(5-cyano-2-methylphenyl)pyrazin-2-yl]-3-fluoro-5-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 70320228 |
| Molecular Formula | C19H14FN5O |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[5-(5-cyano-2-methylphenyl)pyrazin-2-yl]-3-fluoro-5-methylpyridine-4-carboxamide |
| SMILES | Cc1ccc(C#N)cc1-c1cnc(NC(=O)c2c(C)cncc2F)cn1 |
| InChI | InChI=1S/C19H14FN5O/c1-11-3-4-13(6-21)5-14(11)16-9-24-17(10-23-16)25-19(26)18-12(2)7-22-8-15(18)20/h3-5,7-10H,1-2H3,(H,24,25,26) |
| InChIKey | SHNIWRPHMZDGTB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |