C21H17F2N5O2 — CID 70320031
ethenyl 3-[5-[(3,5-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate (PubChem CID 70320031) has the molecular formula C21H17F2N5O2 and a molecular weight of 409.40 g/mol. Its IUPAC name is ethenyl 3-[5-[(3,5-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate.
| Compound Name | ethenyl 3-[5-[(3,5-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate |
|---|---|
| PubChem CID | 70320031 |
| Molecular Formula | C21H17F2N5O2 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | ethenyl 3-[5-[(3,5-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate |
| SMILES | C=CO/C(=N\C)c1ccc(C)c(-c2cnc(NC(=O)c3c(F)cncc3F)cn2)c1 |
| InChI | InChI=1S/C21H17F2N5O2/c1-4-30-21(24-3)13-6-5-12(2)14(7-13)17-10-27-18(11-26-17)28-20(29)19-15(22)8-25-9-16(19)23/h4-11H,1H2,2-3H3,(H,27,28,29)/b24-21- |
| InChIKey | ZJIBKBWUGBZXKP-FLFQWRMESA-N |
| XLogP | 3.91 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|