C21H18FN5O2 — CID 70323331
ethenyl 3-[5-[(3-fluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate (PubChem CID 70323331) has the molecular formula C21H18FN5O2 and a molecular weight of 391.41 g/mol. Its IUPAC name is ethenyl 3-[5-[(3-fluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate.
| Compound Name | ethenyl 3-[5-[(3-fluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate |
|---|---|
| PubChem CID | 70323331 |
| Molecular Formula | C21H18FN5O2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethenyl 3-[5-[(3-fluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-N,4-dimethylbenzenecarboximidate |
| SMILES | C=CO/C(=N\C)c1ccc(C)c(-c2cnc(NC(=O)c3ccncc3F)cn2)c1 |
| InChI | InChI=1S/C21H18FN5O2/c1-4-29-21(23-3)14-6-5-13(2)16(9-14)18-11-26-19(12-25-18)27-20(28)15-7-8-24-10-17(15)22/h4-12H,1H2,2-3H3,(H,26,27,28)/b23-21- |
| InChIKey | XYPFZSNMUAVDLT-LNVKXUELSA-N |
| XLogP | 3.77 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|