About N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide
N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide (PubChem CID 87924083) has the molecular formula C17H9ClF4N4O
and a molecular weight of 396.73 g/mol. Its IUPAC name is N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide |
| PubChem CID | 87924083 |
| Molecular Formula | C17H9ClF4N4O |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide |
| SMILES | Cc1c(F)c(F)c(Cl)c(-c2cnc(NC(=O)c3ccncc3F)cn2)c1F |
| InChI | InChI=1S/C17H9ClF4N4O/c1-7-14(20)12(13(18)16(22)15(7)21)10-5-25-11(6-24-10)26-17(27)8-2-3-23-4-9(8)19/h2-6H,1H3,(H,25,26,27) |
| InChIKey | JWNXRFUZCRRVIL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide?
The IUPAC name of N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide (CID 87924083) is N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide.
What is the SMILES notation for N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide?
The canonical SMILES for N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide is Cc1c(F)c(F)c(Cl)c(-c2cnc(NC(=O)c3ccncc3F)cn2)c1F.
What is the InChIKey of N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide?
The InChIKey is JWNXRFUZCRRVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF4N4O/c1-7-14(20)12(13(18)16(22)15(7)21)10-5-25-11(6-24-10)26-17(27)8-2-3-23-4-9(8)19/h2-6H,1H3,(H,25,26,27).
What are the key properties of N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide?
N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide has a molecular weight of 396.73 g/mol, XLogP of 4.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide is sourced from PubChem (CID 87924083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).