C17H9ClF4N4O — CID 87924083
N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide (PubChem CID 87924083) has the molecular formula C17H9ClF4N4O and a molecular weight of 396.73 g/mol. Its IUPAC name is N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 87924083 |
| Molecular Formula | C17H9ClF4N4O |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[5-(2-chloro-3,4,6-trifluoro-5-methylphenyl)pyrazin-2-yl]-3-fluoropyridine-4-carboxamide |
| SMILES | Cc1c(F)c(F)c(Cl)c(-c2cnc(NC(=O)c3ccncc3F)cn2)c1F |
| InChI | InChI=1S/C17H9ClF4N4O/c1-7-14(20)12(13(18)16(22)15(7)21)10-5-25-11(6-24-10)26-17(27)8-2-3-23-4-9(8)19/h2-6H,1H3,(H,25,26,27) |
| InChIKey | JWNXRFUZCRRVIL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|