C23H22N2O2S — CID 70324208
N-[5-[5-[(Z)-1-ethenoxyprop-1-enyl]-2-methylphenyl]thiophen-2-yl]-3-methylpyridine-4-carboxamide (PubChem CID 70324208) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[5-[5-[(Z)-1-ethenoxyprop-1-enyl]-2-methylphenyl]thiophen-2-yl]-3-methylpyridine-4-carboxamide.
| Compound Name | N-[5-[5-[(Z)-1-ethenoxyprop-1-enyl]-2-methylphenyl]thiophen-2-yl]-3-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 70324208 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[5-[5-[(Z)-1-ethenoxyprop-1-enyl]-2-methylphenyl]thiophen-2-yl]-3-methylpyridine-4-carboxamide |
| SMILES | C=CO/C(=C\C)c1ccc(C)c(-c2ccc(NC(=O)c3ccncc3C)s2)c1 |
| InChI | InChI=1S/C23H22N2O2S/c1-5-20(27-6-2)17-8-7-15(3)19(13-17)21-9-10-22(28-21)25-23(26)18-11-12-24-14-16(18)4/h5-14H,2H2,1,3-4H3,(H,25,26)/b20-5- |
| InChIKey | CMMGGDBYPUMLSC-SDPNRITHSA-N |
| XLogP | 6.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|