C21H17FN2OS2 — CID 143270391
3-fluoro-N-[5-[2-methyl-5-[(1Z)-1-sulfanylbuta-1,3-dienyl]phenyl]thiophen-2-yl]pyridine-4-carboxamide (PubChem CID 143270391) has the molecular formula C21H17FN2OS2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-fluoro-N-[5-[2-methyl-5-[(1Z)-1-sulfanylbuta-1,3-dienyl]phenyl]thiophen-2-yl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[5-[2-methyl-5-[(1Z)-1-sulfanylbuta-1,3-dienyl]phenyl]thiophen-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 143270391 |
| Molecular Formula | C21H17FN2OS2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-fluoro-N-[5-[2-methyl-5-[(1Z)-1-sulfanylbuta-1,3-dienyl]phenyl]thiophen-2-yl]pyridine-4-carboxamide |
| SMILES | C=C/C=C(\S)c1ccc(C)c(-c2ccc(NC(=O)c3ccncc3F)s2)c1 |
| InChI | InChI=1S/C21H17FN2OS2/c1-3-4-18(26)14-6-5-13(2)16(11-14)19-7-8-20(27-19)24-21(25)15-9-10-23-12-17(15)22/h3-12,26H,1H2,2H3,(H,24,25)/b18-4- |
| InChIKey | QETWKGNRVUYQEP-LMXLVEHLSA-N |
| XLogP | 5.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|