C21H16ClFN2O2S — CID 70323825
N-[5-[2-chloro-5-[(Z)-1-ethenoxyprop-1-enyl]phenyl]thiophen-2-yl]-3-fluoropyridine-4-carboxamide (PubChem CID 70323825) has the molecular formula C21H16ClFN2O2S and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[5-[2-chloro-5-[(Z)-1-ethenoxyprop-1-enyl]phenyl]thiophen-2-yl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[5-[2-chloro-5-[(Z)-1-ethenoxyprop-1-enyl]phenyl]thiophen-2-yl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 70323825 |
| Molecular Formula | C21H16ClFN2O2S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[5-[2-chloro-5-[(Z)-1-ethenoxyprop-1-enyl]phenyl]thiophen-2-yl]-3-fluoropyridine-4-carboxamide |
| SMILES | C=CO/C(=C\C)c1ccc(Cl)c(-c2ccc(NC(=O)c3ccncc3F)s2)c1 |
| InChI | InChI=1S/C21H16ClFN2O2S/c1-3-18(27-4-2)13-5-6-16(22)15(11-13)19-7-8-20(28-19)25-21(26)14-9-10-24-12-17(14)23/h3-12H,2H2,1H3,(H,25,26)/b18-3- |
| InChIKey | KLSIETQVQWGBRP-ZUWFHJRGSA-N |
| XLogP | 6.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|