C13H22O4 — CID 160868467
1,3-bis(oxiran-2-yl)propan-2-one;1-ethenoxy-2-methylpropane (PubChem CID 160868467) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1,3-bis(oxiran-2-yl)propan-2-one;1-ethenoxy-2-methylpropane.
| Compound Name | 1,3-bis(oxiran-2-yl)propan-2-one;1-ethenoxy-2-methylpropane |
|---|---|
| PubChem CID | 160868467 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1,3-bis(oxiran-2-yl)propan-2-one;1-ethenoxy-2-methylpropane |
| SMILES | C=COCC(C)C.O=C(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C7H10O3.C6H12O/c8-5(1-6-3-9-6)2-7-4-10-7;1-4-7-5-6(2)3/h6-7H,1-4H2;4,6H,1,5H2,2-3H3 |
| InChIKey | SLLFYRIJQKCKNZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|