C15H22F4N2 — CID 160869175
1-butyl-4-[(3,3,4,4-tetrafluorocyclohexa-1,5-dien-1-yl)methyl]piperazine (PubChem CID 160869175) has the molecular formula C15H22F4N2 and a molecular weight of 306.35 g/mol. Its IUPAC name is 1-butyl-4-[(3,3,4,4-tetrafluorocyclohexa-1,5-dien-1-yl)methyl]piperazine.
| Compound Name | 1-butyl-4-[(3,3,4,4-tetrafluorocyclohexa-1,5-dien-1-yl)methyl]piperazine |
|---|---|
| PubChem CID | 160869175 |
| Molecular Formula | C15H22F4N2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-butyl-4-[(3,3,4,4-tetrafluorocyclohexa-1,5-dien-1-yl)methyl]piperazine |
| SMILES | CCCCN1CCN(CC2=CC(F)(F)C(F)(F)C=C2)CC1 |
| InChI | InChI=1S/C15H22F4N2/c1-2-3-6-20-7-9-21(10-8-20)12-13-4-5-14(16,17)15(18,19)11-13/h4-5,11H,2-3,6-10,12H2,1H3 |
| InChIKey | SLNLZKONPHZECQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|