About tert-butyl ethanedithioate
tert-butyl ethanedithioate (PubChem CID 160870150) has the molecular formula C12H24S4
and a molecular weight of 296.59 g/mol. Its IUPAC name is tert-butyl ethanedithioate.
Molecular Properties
| Compound Name | tert-butyl ethanedithioate |
| PubChem CID | 160870150 |
| Molecular Formula | C12H24S4 |
| Molecular Weight | 296.59 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | tert-butyl ethanedithioate |
| SMILES | CC(=S)SC(C)(C)C.CC(=S)SC(C)(C)C |
| InChI | InChI=1S/2C6H12S2/c2*1-5(7)8-6(2,3)4/h2*1-4H3 |
| InChIKey | SLQMXWXTSOJDHN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl ethanedithioate?
The IUPAC name of tert-butyl ethanedithioate (CID 160870150) is tert-butyl ethanedithioate.
What is the SMILES notation for tert-butyl ethanedithioate?
The canonical SMILES for tert-butyl ethanedithioate is CC(=S)SC(C)(C)C.CC(=S)SC(C)(C)C.
What is the InChIKey of tert-butyl ethanedithioate?
The InChIKey is SLQMXWXTSOJDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12S2/c2*1-5(7)8-6(2,3)4/h2*1-4H3.
What are the key properties of tert-butyl ethanedithioate?
tert-butyl ethanedithioate has a molecular weight of 296.59 g/mol, XLogP of 5.73, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl ethanedithioate is sourced from PubChem (CID 160870150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).