C11H21NS3 — CID 173452392
2,3-bis(tert-butylsulfanyl)prop-2-enethioamide (PubChem CID 173452392) has the molecular formula C11H21NS3 and a molecular weight of 263.50 g/mol. Its IUPAC name is 2,3-bis(tert-butylsulfanyl)prop-2-enethioamide.
| Compound Name | 2,3-bis(tert-butylsulfanyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 173452392 |
| Molecular Formula | C11H21NS3 |
| Molecular Weight | 263.50 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2,3-bis(tert-butylsulfanyl)prop-2-enethioamide |
| SMILES | CC(C)(C)SC=C(SC(C)(C)C)C(N)=S |
| InChI | InChI=1S/C11H21NS3/c1-10(2,3)14-7-8(9(12)13)15-11(4,5)6/h7H,1-6H3,(H2,12,13) |
| InChIKey | LQGJBJLUYKVSSL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|